C17H17ClFNO5S — CID 9438977
N-(4-chloro-2,5-dimethoxyphenyl)-3-(4-fluorophenyl)sulfonylpropanamide (PubChem CID 9438977) has the molecular formula C17H17ClFNO5S and a molecular weight of 401.84 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-3-(4-fluorophenyl)sulfonylpropanamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-(4-fluorophenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 9438977 |
| Molecular Formula | C17H17ClFNO5S |
| Molecular Weight | 401.84 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-(4-fluorophenyl)sulfonylpropanamide |
| SMILES | COc1cc(NC(=O)CCS(=O)(=O)c2ccc(F)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C17H17ClFNO5S/c1-24-15-10-14(16(25-2)9-13(15)18)20-17(21)7-8-26(22,23)12-5-3-11(19)4-6-12/h3-6,9-10H,7-8H2,1-2H3,(H,20,21) |
| InChIKey | QHSDOVWSKPSMIX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.84 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |