C17H16ClN5O4 — CID 1139897
N-(4-chloro-2,5-dimethoxyphenyl)-2-[4-(tetrazol-1-yl)phenoxy]acetamide (PubChem CID 1139897) has the molecular formula C17H16ClN5O4 and a molecular weight of 389.80 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-2-[4-(tetrazol-1-yl)phenoxy]acetamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-[4-(tetrazol-1-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 1139897 |
| Molecular Formula | C17H16ClN5O4 |
| Molecular Weight | 389.80 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-[4-(tetrazol-1-yl)phenoxy]acetamide |
| SMILES | COc1cc(NC(=O)COc2ccc(-n3cnnn3)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C17H16ClN5O4/c1-25-15-8-14(16(26-2)7-13(15)18)20-17(24)9-27-12-5-3-11(4-6-12)23-10-19-21-22-23/h3-8,10H,9H2,1-2H3,(H,20,24) |
| InChIKey | RJUHDYCEANVLOG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.80 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |