C15H19FN2O — CID 75448080
N-(3,3-dimethylbutan-2-yl)-6-fluoro-1H-indole-3-carboxamide (PubChem CID 75448080) has the molecular formula C15H19FN2O and a molecular weight of 262.33 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-6-fluoro-1H-indole-3-carboxamide.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-6-fluoro-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 75448080 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-6-fluoro-1H-indole-3-carboxamide |
| SMILES | CC(NC(=O)c1c[nH]c2cc(F)ccc12)C(C)(C)C |
| InChI | InChI=1S/C15H19FN2O/c1-9(15(2,3)4)18-14(19)12-8-17-13-7-10(16)5-6-11(12)13/h5-9,17H,1-4H3,(H,18,19) |
| InChIKey | ISUZWTDAMHKKLD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |