C15H7F4NO — CID 63187418
(6-fluoro-1H-indol-3-yl)-(3,4,5-trifluorophenyl)methanone (PubChem CID 63187418) has the molecular formula C15H7F4NO and a molecular weight of 293.22 g/mol. Its IUPAC name is (6-fluoro-1H-indol-3-yl)-(3,4,5-trifluorophenyl)methanone.
| Compound Name | (6-fluoro-1H-indol-3-yl)-(3,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 63187418 |
| Molecular Formula | C15H7F4NO |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | (6-fluoro-1H-indol-3-yl)-(3,4,5-trifluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)c(F)c1)c1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C15H7F4NO/c16-8-1-2-9-10(6-20-13(9)5-8)15(21)7-3-11(17)14(19)12(18)4-7/h1-6,20H |
| InChIKey | UVLFGCDEZQWGKU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|