C17H14FNO — CID 43342049
(2,3-dimethylphenyl)-(6-fluoro-1H-indol-3-yl)methanone (PubChem CID 43342049) has the molecular formula C17H14FNO and a molecular weight of 267.30 g/mol. Its IUPAC name is (2,3-dimethylphenyl)-(6-fluoro-1H-indol-3-yl)methanone.
| Compound Name | (2,3-dimethylphenyl)-(6-fluoro-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 43342049 |
| Molecular Formula | C17H14FNO |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (2,3-dimethylphenyl)-(6-fluoro-1H-indol-3-yl)methanone |
| SMILES | Cc1cccc(C(=O)c2c[nH]c3cc(F)ccc23)c1C |
| InChI | InChI=1S/C17H14FNO/c1-10-4-3-5-13(11(10)2)17(20)15-9-19-16-8-12(18)6-7-14(15)16/h3-9,19H,1-2H3 |
| InChIKey | CKASDZOVZXZNQC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |