C18H14N2O — CID 107916755
3-(2,3-dimethylbenzoyl)-1H-indole-6-carbonitrile (PubChem CID 107916755) has the molecular formula C18H14N2O and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-(2,3-dimethylbenzoyl)-1H-indole-6-carbonitrile.
| Compound Name | 3-(2,3-dimethylbenzoyl)-1H-indole-6-carbonitrile |
|---|---|
| PubChem CID | 107916755 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-(2,3-dimethylbenzoyl)-1H-indole-6-carbonitrile |
| SMILES | Cc1cccc(C(=O)c2c[nH]c3cc(C#N)ccc23)c1C |
| InChI | InChI=1S/C18H14N2O/c1-11-4-3-5-14(12(11)2)18(21)16-10-20-17-8-13(9-19)6-7-15(16)17/h3-8,10,20H,1-2H3 |
| InChIKey | YYLUJYNBBGSYSI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |