C19H19FN4OS — CID 78903656
6-fluoro-N-(4-piperidin-1-ylphenyl)-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide (PubChem CID 78903656) has the molecular formula C19H19FN4OS and a molecular weight of 370.45 g/mol. Its IUPAC name is 6-fluoro-N-(4-piperidin-1-ylphenyl)-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide.
| Compound Name | 6-fluoro-N-(4-piperidin-1-ylphenyl)-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 78903656 |
| Molecular Formula | C19H19FN4OS |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 6-fluoro-N-(4-piperidin-1-ylphenyl)-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)c1cc(F)cc2[nH]c(=S)[nH]c12 |
| InChI | InChI=1S/C19H19FN4OS/c20-12-10-15(17-16(11-12)22-19(26)23-17)18(25)21-13-4-6-14(7-5-13)24-8-2-1-3-9-24/h4-7,10-11H,1-3,8-9H2,(H,21,25)(H2,22,23,26) |
| InChIKey | FJPKZWQSYQBIHZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 63.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|