C19H17FN2O4 — CID 113212461
1-acetyl-N-(3,4-dimethoxyphenyl)-5-fluoroindole-3-carboxamide (PubChem CID 113212461) has the molecular formula C19H17FN2O4 and a molecular weight of 356.35 g/mol. Its IUPAC name is 1-acetyl-N-(3,4-dimethoxyphenyl)-5-fluoroindole-3-carboxamide.
| Compound Name | 1-acetyl-N-(3,4-dimethoxyphenyl)-5-fluoroindole-3-carboxamide |
|---|---|
| PubChem CID | 113212461 |
| Molecular Formula | C19H17FN2O4 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 1-acetyl-N-(3,4-dimethoxyphenyl)-5-fluoroindole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cn(C(C)=O)c3ccc(F)cc23)cc1OC |
| InChI | InChI=1S/C19H17FN2O4/c1-11(23)22-10-15(14-8-12(20)4-6-16(14)22)19(24)21-13-5-7-17(25-2)18(9-13)26-3/h4-10H,1-3H3,(H,21,24) |
| InChIKey | FHWMLJCKMNDOEN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |