C18H13FN2O4 — CID 113213026
1-acetyl-N-(1,3-benzodioxol-5-yl)-6-fluoroindole-3-carboxamide (PubChem CID 113213026) has the molecular formula C18H13FN2O4 and a molecular weight of 340.31 g/mol. Its IUPAC name is 1-acetyl-N-(1,3-benzodioxol-5-yl)-6-fluoroindole-3-carboxamide.
| Compound Name | 1-acetyl-N-(1,3-benzodioxol-5-yl)-6-fluoroindole-3-carboxamide |
|---|---|
| PubChem CID | 113213026 |
| Molecular Formula | C18H13FN2O4 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 1-acetyl-N-(1,3-benzodioxol-5-yl)-6-fluoroindole-3-carboxamide |
| SMILES | CC(=O)n1cc(C(=O)Nc2ccc3c(c2)OCO3)c2ccc(F)cc21 |
| InChI | InChI=1S/C18H13FN2O4/c1-10(22)21-8-14(13-4-2-11(19)6-15(13)21)18(23)20-12-3-5-16-17(7-12)25-9-24-16/h2-8H,9H2,1H3,(H,20,23) |
| InChIKey | IOYGSVVYXYWTHY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |