C16H13F2NO3 — CID 30501354
N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2,5-difluorobenzamide (PubChem CID 30501354) has the molecular formula C16H13F2NO3 and a molecular weight of 305.28 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2,5-difluorobenzamide.
| Compound Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 30501354 |
| Molecular Formula | C16H13F2NO3 |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2,5-difluorobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCCO2)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H13F2NO3/c17-10-2-4-13(18)12(8-10)16(20)19-11-3-5-14-15(9-11)22-7-1-6-21-14/h2-5,8-9H,1,6-7H2,(H,19,20) |
| InChIKey | GGWHVSBQQDTEKT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |