C17H19F2N3O — CID 3383505
1-[4-(diethylamino)phenyl]-3-(2,5-difluorophenyl)urea (PubChem CID 3383505) has the molecular formula C17H19F2N3O and a molecular weight of 319.36 g/mol. Its IUPAC name is 1-[4-(diethylamino)phenyl]-3-(2,5-difluorophenyl)urea.
| Compound Name | 1-[4-(diethylamino)phenyl]-3-(2,5-difluorophenyl)urea |
|---|---|
| PubChem CID | 3383505 |
| Molecular Formula | C17H19F2N3O |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-[4-(diethylamino)phenyl]-3-(2,5-difluorophenyl)urea |
| SMILES | CCN(CC)c1ccc(NC(=O)Nc2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C17H19F2N3O/c1-3-22(4-2)14-8-6-13(7-9-14)20-17(23)21-16-11-12(18)5-10-15(16)19/h5-11H,3-4H2,1-2H3,(H2,20,21,23) |
| InChIKey | BPOBILFIOOLTHZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|