C18H20FN3O2 — CID 108512632
N-[4-(diethylamino)phenyl]-N'-(4-fluorophenyl)oxamide (PubChem CID 108512632) has the molecular formula C18H20FN3O2 and a molecular weight of 329.38 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-N'-(4-fluorophenyl)oxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-N'-(4-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 108512632 |
| Molecular Formula | C18H20FN3O2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-N'-(4-fluorophenyl)oxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H20FN3O2/c1-3-22(4-2)16-11-9-15(10-12-16)21-18(24)17(23)20-14-7-5-13(19)6-8-14/h5-12H,3-4H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | OOVFNPCTMXUQFP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|