C18H22N4O4S — CID 108508799
N-[4-(diethylamino)phenyl]-N'-(4-sulfamoylphenyl)oxamide (PubChem CID 108508799) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-N'-(4-sulfamoylphenyl)oxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-N'-(4-sulfamoylphenyl)oxamide |
|---|---|
| PubChem CID | 108508799 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-N'-(4-sulfamoylphenyl)oxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H22N4O4S/c1-3-22(4-2)15-9-5-13(6-10-15)20-17(23)18(24)21-14-7-11-16(12-8-14)27(19,25)26/h5-12H,3-4H2,1-2H3,(H,20,23)(H,21,24)(H2,19,25,26) |
| InChIKey | JCQYEHFTIMWFBP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|