C20H26N4O4S — CID 108520359
N'-[4-(diethylamino)-2-methylphenyl]-N-[(4-sulfamoylphenyl)methyl]oxamide (PubChem CID 108520359) has the molecular formula C20H26N4O4S and a molecular weight of 418.52 g/mol. Its IUPAC name is N'-[4-(diethylamino)-2-methylphenyl]-N-[(4-sulfamoylphenyl)methyl]oxamide.
| Compound Name | N'-[4-(diethylamino)-2-methylphenyl]-N-[(4-sulfamoylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 108520359 |
| Molecular Formula | C20H26N4O4S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N'-[4-(diethylamino)-2-methylphenyl]-N-[(4-sulfamoylphenyl)methyl]oxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(=O)NCc2ccc(S(N)(=O)=O)cc2)c(C)c1 |
| InChI | InChI=1S/C20H26N4O4S/c1-4-24(5-2)16-8-11-18(14(3)12-16)23-20(26)19(25)22-13-15-6-9-17(10-7-15)29(21,27)28/h6-12H,4-5,13H2,1-3H3,(H,22,25)(H,23,26)(H2,21,27,28) |
| InChIKey | OTITYWJJJHERBZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|