C15H20N6O2 — CID 108519226
N-[4-(diethylamino)-2-methylphenyl]-N'-(1,2,4-triazol-4-yl)oxamide (PubChem CID 108519226) has the molecular formula C15H20N6O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-N'-(1,2,4-triazol-4-yl)oxamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-N'-(1,2,4-triazol-4-yl)oxamide |
|---|---|
| PubChem CID | 108519226 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-N'-(1,2,4-triazol-4-yl)oxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(=O)Nn2cnnc2)c(C)c1 |
| InChI | InChI=1S/C15H20N6O2/c1-4-20(5-2)12-6-7-13(11(3)8-12)18-14(22)15(23)19-21-9-16-17-10-21/h6-10H,4-5H2,1-3H3,(H,18,22)(H,19,23) |
| InChIKey | JTIQHEQRPYOOLF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|