C18H29N3O3 — CID 108525861
N'-[4-(diethylamino)-2-methylphenyl]-N-(5-hydroxypentyl)oxamide (PubChem CID 108525861) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is N'-[4-(diethylamino)-2-methylphenyl]-N-(5-hydroxypentyl)oxamide.
| Compound Name | N'-[4-(diethylamino)-2-methylphenyl]-N-(5-hydroxypentyl)oxamide |
|---|---|
| PubChem CID | 108525861 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | N'-[4-(diethylamino)-2-methylphenyl]-N-(5-hydroxypentyl)oxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(=O)NCCCCCO)c(C)c1 |
| InChI | InChI=1S/C18H29N3O3/c1-4-21(5-2)15-9-10-16(14(3)13-15)20-18(24)17(23)19-11-7-6-8-12-22/h9-10,13,22H,4-8,11-12H2,1-3H3,(H,19,23)(H,20,24) |
| InChIKey | FGGFBINTVLRTPQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|