C21H27N3O3 — CID 108503202
N'-[4-(diethylamino)-2-methylphenyl]-N-[2-(4-hydroxyphenyl)ethyl]oxamide (PubChem CID 108503202) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is N'-[4-(diethylamino)-2-methylphenyl]-N-[2-(4-hydroxyphenyl)ethyl]oxamide.
| Compound Name | N'-[4-(diethylamino)-2-methylphenyl]-N-[2-(4-hydroxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108503202 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N'-[4-(diethylamino)-2-methylphenyl]-N-[2-(4-hydroxyphenyl)ethyl]oxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(=O)NCCc2ccc(O)cc2)c(C)c1 |
| InChI | InChI=1S/C21H27N3O3/c1-4-24(5-2)17-8-11-19(15(3)14-17)23-21(27)20(26)22-13-12-16-6-9-18(25)10-7-16/h6-11,14,25H,4-5,12-13H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | KOADYINFOGHHNY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|