C19H21F2N3O2 — CID 108522130
N-[4-(diethylamino)-2-methylphenyl]-N'-(2,6-difluorophenyl)oxamide (PubChem CID 108522130) has the molecular formula C19H21F2N3O2 and a molecular weight of 361.39 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-N'-(2,6-difluorophenyl)oxamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-N'-(2,6-difluorophenyl)oxamide |
|---|---|
| PubChem CID | 108522130 |
| Molecular Formula | C19H21F2N3O2 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-N'-(2,6-difluorophenyl)oxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(=O)Nc2c(F)cccc2F)c(C)c1 |
| InChI | InChI=1S/C19H21F2N3O2/c1-4-24(5-2)13-9-10-16(12(3)11-13)22-18(25)19(26)23-17-14(20)7-6-8-15(17)21/h6-11H,4-5H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | SNMZFDQXVFBFKO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|