C15H21BrN2O2 — CID 47148018
N'-(4-bromo-2-methylphenyl)-N-hexyloxamide (PubChem CID 47148018) has the molecular formula C15H21BrN2O2 and a molecular weight of 341.25 g/mol. Its IUPAC name is N'-(4-bromo-2-methylphenyl)-N-hexyloxamide.
| Compound Name | N'-(4-bromo-2-methylphenyl)-N-hexyloxamide |
|---|---|
| PubChem CID | 47148018 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | N'-(4-bromo-2-methylphenyl)-N-hexyloxamide |
| SMILES | CCCCCCNC(=O)C(=O)Nc1ccc(Br)cc1C |
| InChI | InChI=1S/C15H21BrN2O2/c1-3-4-5-6-9-17-14(19)15(20)18-13-8-7-12(16)10-11(13)2/h7-8,10H,3-6,9H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | CIOICCKFNBCPRX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|