C16H16BrN3O4S — CID 108520368
N'-(4-bromo-2-methylphenyl)-N-[(4-sulfamoylphenyl)methyl]oxamide (PubChem CID 108520368) has the molecular formula C16H16BrN3O4S and a molecular weight of 426.29 g/mol. Its IUPAC name is N'-(4-bromo-2-methylphenyl)-N-[(4-sulfamoylphenyl)methyl]oxamide.
| Compound Name | N'-(4-bromo-2-methylphenyl)-N-[(4-sulfamoylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 108520368 |
| Molecular Formula | C16H16BrN3O4S |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | N'-(4-bromo-2-methylphenyl)-N-[(4-sulfamoylphenyl)methyl]oxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)C(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H16BrN3O4S/c1-10-8-12(17)4-7-14(10)20-16(22)15(21)19-9-11-2-5-13(6-3-11)25(18,23)24/h2-8H,9H2,1H3,(H,19,21)(H,20,22)(H2,18,23,24) |
| InChIKey | YLKBXTYPQKQZQB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|