C15H12Br2N2O2 — CID 108531900
N-(4-bromo-2-methylphenyl)-N'-(2-bromophenyl)oxamide (PubChem CID 108531900) has the molecular formula C15H12Br2N2O2 and a molecular weight of 412.08 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-N'-(2-bromophenyl)oxamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-N'-(2-bromophenyl)oxamide |
|---|---|
| PubChem CID | 108531900 |
| Molecular Formula | C15H12Br2N2O2 |
| Molecular Weight | 412.08 g/mol |
| Exact Mass | 409.93 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-N'-(2-bromophenyl)oxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)C(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C15H12Br2N2O2/c1-9-8-10(16)6-7-12(9)18-14(20)15(21)19-13-5-3-2-4-11(13)17/h2-8H,1H3,(H,18,20)(H,19,21) |
| InChIKey | QQDSQGIAQKMRJK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.08 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|