C15H13BrClN3O2 — CID 108516290
N'-(4-amino-2-chlorophenyl)-N-(4-bromo-2-methylphenyl)oxamide (PubChem CID 108516290) has the molecular formula C15H13BrClN3O2 and a molecular weight of 382.65 g/mol. Its IUPAC name is N'-(4-amino-2-chlorophenyl)-N-(4-bromo-2-methylphenyl)oxamide.
| Compound Name | N'-(4-amino-2-chlorophenyl)-N-(4-bromo-2-methylphenyl)oxamide |
|---|---|
| PubChem CID | 108516290 |
| Molecular Formula | C15H13BrClN3O2 |
| Molecular Weight | 382.65 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | N'-(4-amino-2-chlorophenyl)-N-(4-bromo-2-methylphenyl)oxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)C(=O)Nc1ccc(N)cc1Cl |
| InChI | InChI=1S/C15H13BrClN3O2/c1-8-6-9(16)2-4-12(8)19-14(21)15(22)20-13-5-3-10(18)7-11(13)17/h2-7H,18H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | OJSMEBCTWMZHPK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.65 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|