C10H13N3O5S — CID 108508767
N-(2-hydroxyethyl)-N'-(4-sulfamoylphenyl)oxamide (PubChem CID 108508767) has the molecular formula C10H13N3O5S and a molecular weight of 287.30 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N'-(4-sulfamoylphenyl)oxamide.
| Compound Name | N-(2-hydroxyethyl)-N'-(4-sulfamoylphenyl)oxamide |
|---|---|
| PubChem CID | 108508767 |
| Molecular Formula | C10H13N3O5S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | N-(2-hydroxyethyl)-N'-(4-sulfamoylphenyl)oxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C(=O)NCCO)cc1 |
| InChI | InChI=1S/C10H13N3O5S/c11-19(17,18)8-3-1-7(2-4-8)13-10(16)9(15)12-5-6-14/h1-4,14H,5-6H2,(H,12,15)(H,13,16)(H2,11,17,18) |
| InChIKey | FTDVTGXDCOMXQV-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|