C12H17N3O5S — CID 108508740
N'-ethyl-N'-(2-hydroxyethyl)-N-(4-sulfamoylphenyl)oxamide (PubChem CID 108508740) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is N'-ethyl-N'-(2-hydroxyethyl)-N-(4-sulfamoylphenyl)oxamide.
| Compound Name | N'-ethyl-N'-(2-hydroxyethyl)-N-(4-sulfamoylphenyl)oxamide |
|---|---|
| PubChem CID | 108508740 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N'-ethyl-N'-(2-hydroxyethyl)-N-(4-sulfamoylphenyl)oxamide |
| SMILES | CCN(CCO)C(=O)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H17N3O5S/c1-2-15(7-8-16)12(18)11(17)14-9-3-5-10(6-4-9)21(13,19)20/h3-6,16H,2,7-8H2,1H3,(H,14,17)(H2,13,19,20) |
| InChIKey | RRGKQPXGLKLZIS-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|