C13H23N3O2S3 — CID 5359215
N,N-diethylethanamine;(4-sulfamoylphenyl)carbamodithioic acid (PubChem CID 5359215) has the molecular formula C13H23N3O2S3 and a molecular weight of 349.55 g/mol. Its IUPAC name is N,N-diethylethanamine;(4-sulfamoylphenyl)carbamodithioic acid.
| Compound Name | N,N-diethylethanamine;(4-sulfamoylphenyl)carbamodithioic acid |
|---|---|
| PubChem CID | 5359215 |
| Molecular Formula | C13H23N3O2S3 |
| Molecular Weight | 349.55 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N,N-diethylethanamine;(4-sulfamoylphenyl)carbamodithioic acid |
| SMILES | CCN(CC)CC.NS(=O)(=O)c1ccc(NC(=S)S)cc1 |
| InChI | InChI=1S/C7H8N2O2S3.C6H15N/c8-14(10,11)6-3-1-5(2-4-6)9-7(12)13;1-4-7(5-2)6-3/h1-4H,(H2,8,10,11)(H2,9,12,13);4-6H2,1-3H3 |
| InChIKey | VNNJMPJLPASSAB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.55 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|