C9H12N2O2S3 — CID 82593514
2-(4-sulfamoylphenyl)ethylcarbamodithioic acid (PubChem CID 82593514) has the molecular formula C9H12N2O2S3 and a molecular weight of 276.41 g/mol. Its IUPAC name is 2-(4-sulfamoylphenyl)ethylcarbamodithioic acid.
| Compound Name | 2-(4-sulfamoylphenyl)ethylcarbamodithioic acid |
|---|---|
| PubChem CID | 82593514 |
| Molecular Formula | C9H12N2O2S3 |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 2-(4-sulfamoylphenyl)ethylcarbamodithioic acid |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=S)S)cc1 |
| InChI | InChI=1S/C9H12N2O2S3/c10-16(12,13)8-3-1-7(2-4-8)5-6-11-9(14)15/h1-4H,5-6H2,(H2,10,12,13)(H2,11,14,15) |
| InChIKey | AFJLPUZDDRARNP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|