C15H16ClN3O2S2 — CID 1213468
1-[2-(4-chlorophenyl)ethyl]-3-(4-sulfamoylphenyl)thiourea (PubChem CID 1213468) has the molecular formula C15H16ClN3O2S2 and a molecular weight of 369.90 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 1213468 |
| Molecular Formula | C15H16ClN3O2S2 |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-3-(4-sulfamoylphenyl)thiourea |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)NCCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C15H16ClN3O2S2/c16-12-3-1-11(2-4-12)9-10-18-15(22)19-13-5-7-14(8-6-13)23(17,20)21/h1-8H,9-10H2,(H2,17,20,21)(H2,18,19,22) |
| InChIKey | DHUQTONICQPUCG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|