C14H13Cl2N3O2S2 — CID 19649416
1-[(3,4-dichlorophenyl)methyl]-3-(4-sulfamoylphenyl)thiourea (PubChem CID 19649416) has the molecular formula C14H13Cl2N3O2S2 and a molecular weight of 390.32 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 19649416 |
| Molecular Formula | C14H13Cl2N3O2S2 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-(4-sulfamoylphenyl)thiourea |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)NCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C14H13Cl2N3O2S2/c15-12-6-1-9(7-13(12)16)8-18-14(22)19-10-2-4-11(5-3-10)23(17,20)21/h1-7H,8H2,(H2,17,20,21)(H2,18,19,22) |
| InChIKey | QEEUDYKAUXIWBI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|