C15H14Cl2N4O3S2 — CID 5470531
1-(3,4-dichlorophenyl)-3-[(4-sulfamoylphenyl)methylcarbamothioyl]urea (PubChem CID 5470531) has the molecular formula C15H14Cl2N4O3S2 and a molecular weight of 433.34 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[(4-sulfamoylphenyl)methylcarbamothioyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[(4-sulfamoylphenyl)methylcarbamothioyl]urea |
|---|---|
| PubChem CID | 5470531 |
| Molecular Formula | C15H14Cl2N4O3S2 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[(4-sulfamoylphenyl)methylcarbamothioyl]urea |
| SMILES | NS(=O)(=O)c1ccc(CNC(=S)NC(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H14Cl2N4O3S2/c16-12-6-3-10(7-13(12)17)20-14(22)21-15(25)19-8-9-1-4-11(5-2-9)26(18,23)24/h1-7H,8H2,(H2,18,23,24)(H3,19,20,21,22,25) |
| InChIKey | DLLSQQSPPYJHJW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|