C14H14ClN3O2S2 — CID 2212502
1-(3-chloro-4-methylphenyl)-3-(4-sulfamoylphenyl)thiourea (PubChem CID 2212502) has the molecular formula C14H14ClN3O2S2 and a molecular weight of 355.87 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 2212502 |
| Molecular Formula | C14H14ClN3O2S2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-(4-sulfamoylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccc(S(N)(=O)=O)cc2)cc1Cl |
| InChI | InChI=1S/C14H14ClN3O2S2/c1-9-2-3-11(8-13(9)15)18-14(21)17-10-4-6-12(7-5-10)22(16,19)20/h2-8H,1H3,(H2,16,19,20)(H2,17,18,21) |
| InChIKey | IEISZBDYZRBZOK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|