C17H20ClN3O2S2 — CID 5217438
1-(3-chloro-4-methylphenyl)-3-[3-(dimethylsulfamoyl)-4-methylphenyl]thiourea (PubChem CID 5217438) has the molecular formula C17H20ClN3O2S2 and a molecular weight of 397.95 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[3-(dimethylsulfamoyl)-4-methylphenyl]thiourea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[3-(dimethylsulfamoyl)-4-methylphenyl]thiourea |
|---|---|
| PubChem CID | 5217438 |
| Molecular Formula | C17H20ClN3O2S2 |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[3-(dimethylsulfamoyl)-4-methylphenyl]thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccc(C)c(S(=O)(=O)N(C)C)c2)cc1Cl |
| InChI | InChI=1S/C17H20ClN3O2S2/c1-11-5-7-13(9-15(11)18)19-17(24)20-14-8-6-12(2)16(10-14)25(22,23)21(3)4/h5-10H,1-4H3,(H2,19,20,24) |
| InChIKey | LPITUKVMSNKVFH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|