C17H27N3O2S2 — CID 8614468
1-[3-(dimethylsulfamoyl)-4-methylphenyl]-3-[(1R,2R)-2-methylcyclohexyl]thiourea (PubChem CID 8614468) has the molecular formula C17H27N3O2S2 and a molecular weight of 369.56 g/mol. Its IUPAC name is 1-[3-(dimethylsulfamoyl)-4-methylphenyl]-3-[(1R,2R)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-[3-(dimethylsulfamoyl)-4-methylphenyl]-3-[(1R,2R)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 8614468 |
| Molecular Formula | C17H27N3O2S2 |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 1-[3-(dimethylsulfamoyl)-4-methylphenyl]-3-[(1R,2R)-2-methylcyclohexyl]thiourea |
| SMILES | Cc1ccc(NC(=S)N[C@@H]2CCCC[C@H]2C)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C17H27N3O2S2/c1-12-7-5-6-8-15(12)19-17(23)18-14-10-9-13(2)16(11-14)24(21,22)20(3)4/h9-12,15H,5-8H2,1-4H3,(H2,18,19,23)/t12-,15-/m1/s1 |
| InChIKey | HXBYADVZZXKSBC-IUODEOHRSA-N |
| XLogP | 3.11 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|