C15H20N4OS — CID 8615405
1-[(1S,2S)-2-methylcyclohexyl]-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)thiourea (PubChem CID 8615405) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 1-[(1S,2S)-2-methylcyclohexyl]-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)thiourea.
| Compound Name | 1-[(1S,2S)-2-methylcyclohexyl]-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)thiourea |
|---|---|
| PubChem CID | 8615405 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-[(1S,2S)-2-methylcyclohexyl]-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)thiourea |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=S)Nc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C15H20N4OS/c1-9-4-2-3-5-11(9)19-15(21)16-10-6-7-12-13(8-10)18-14(20)17-12/h6-9,11H,2-5H2,1H3,(H2,16,19,21)(H2,17,18,20)/t9-,11-/m0/s1 |
| InChIKey | HEEIOCBSOWVLOO-ONGXEEELSA-N |
| XLogP | 2.72 |
| TPSA | 72.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|