C14H18F2N2S — CID 8669123
1-(3,4-difluorophenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea (PubChem CID 8669123) has the molecular formula C14H18F2N2S and a molecular weight of 284.38 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-(3,4-difluorophenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 8669123 |
| Molecular Formula | C14H18F2N2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea |
| SMILES | C[C@H]1CCCC[C@H]1NC(=S)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H18F2N2S/c1-9-4-2-3-5-13(9)18-14(19)17-10-6-7-11(15)12(16)8-10/h6-9,13H,2-5H2,1H3,(H2,17,18,19)/t9-,13+/m0/s1 |
| InChIKey | HZTMGKAOCCOTTB-TVQRCGJNSA-N |
| XLogP | 3.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|