C15H20FN3O2 — CID 94059666
2-fluoro-5-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]benzamide (PubChem CID 94059666) has the molecular formula C15H20FN3O2 and a molecular weight of 293.34 g/mol. Its IUPAC name is 2-fluoro-5-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]benzamide.
| Compound Name | 2-fluoro-5-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 94059666 |
| Molecular Formula | C15H20FN3O2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2-fluoro-5-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]benzamide |
| SMILES | C[C@H]1CCCC[C@H]1NC(=O)Nc1ccc(F)c(C(N)=O)c1 |
| InChI | InChI=1S/C15H20FN3O2/c1-9-4-2-3-5-13(9)19-15(21)18-10-6-7-12(16)11(8-10)14(17)20/h6-9,13H,2-5H2,1H3,(H2,17,20)(H2,18,19,21)/t9-,13+/m0/s1 |
| InChIKey | ZJMQXBUBQGWNIQ-TVQRCGJNSA-N |
| XLogP | 2.62 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |