C18H29N3O2S2 — CID 7943135
1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-[5-(dimethylsulfamoyl)-2-methylphenyl]thiourea (PubChem CID 7943135) has the molecular formula C18H29N3O2S2 and a molecular weight of 383.58 g/mol. Its IUPAC name is 1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-[5-(dimethylsulfamoyl)-2-methylphenyl]thiourea.
| Compound Name | 1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-[5-(dimethylsulfamoyl)-2-methylphenyl]thiourea |
|---|---|
| PubChem CID | 7943135 |
| Molecular Formula | C18H29N3O2S2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-[5-(dimethylsulfamoyl)-2-methylphenyl]thiourea |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=S)N[C@@H]1CCC[C@H](C)[C@H]1C |
| InChI | InChI=1S/C18H29N3O2S2/c1-12-7-6-8-16(14(12)3)19-18(24)20-17-11-15(10-9-13(17)2)25(22,23)21(4)5/h9-12,14,16H,6-8H2,1-5H3,(H2,19,20,24)/t12-,14+,16+/m0/s1 |
| InChIKey | HBPCLWDVOVVJRO-JGGQBBKZSA-N |
| XLogP | 3.36 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|