C17H24N2O2S — CID 8659762
methyl 4-methyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]benzoate (PubChem CID 8659762) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is methyl 4-methyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]benzoate.
| Compound Name | methyl 4-methyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 8659762 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | methyl 4-methyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=S)N[C@@H]2CCCC[C@H]2C)c1 |
| InChI | InChI=1S/C17H24N2O2S/c1-11-6-4-5-7-14(11)18-17(22)19-15-10-13(16(20)21-3)9-8-12(15)2/h8-11,14H,4-7H2,1-3H3,(H2,18,19,22)/t11-,14-/m1/s1 |
| InChIKey | OUXMSLCMCQTREM-BXUZGUMPSA-N |
| XLogP | 3.65 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|