C17H22N2O2S — CID 100593319
methyl 3-[[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]carbamothioylamino]-4-methylbenzoate (PubChem CID 100593319) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is methyl 3-[[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]carbamothioylamino]-4-methylbenzoate.
| Compound Name | methyl 3-[[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]carbamothioylamino]-4-methylbenzoate |
|---|---|
| PubChem CID | 100593319 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | methyl 3-[[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]carbamothioylamino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=S)N[C@H]2C[C@@H]3CC[C@@H]2C3)c1 |
| InChI | InChI=1S/C17H22N2O2S/c1-10-3-5-13(16(20)21-2)9-14(10)18-17(22)19-15-8-11-4-6-12(15)7-11/h3,5,9,11-12,15H,4,6-8H2,1-2H3,(H2,18,19,22)/t11-,12-,15+/m1/s1 |
| InChIKey | IXVKXGVBCOPREZ-JMSVASOKSA-N |
| XLogP | 3.26 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|