C17H24N4S2 — CID 11888736
1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2,4-dimethylphenyl)carbamothioylamino]thiourea (PubChem CID 11888736) has the molecular formula C17H24N4S2 and a molecular weight of 348.54 g/mol. Its IUPAC name is 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2,4-dimethylphenyl)carbamothioylamino]thiourea.
| Compound Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2,4-dimethylphenyl)carbamothioylamino]thiourea |
|---|---|
| PubChem CID | 11888736 |
| Molecular Formula | C17H24N4S2 |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2,4-dimethylphenyl)carbamothioylamino]thiourea |
| SMILES | Cc1ccc(NC(=S)NNC(=S)N[C@@H]2C[C@H]3CC[C@@H]2C3)c(C)c1 |
| InChI | InChI=1S/C17H24N4S2/c1-10-3-6-14(11(2)7-10)18-16(22)20-21-17(23)19-15-9-12-4-5-13(15)8-12/h3,6-7,12-13,15H,4-5,8-9H2,1-2H3,(H2,18,20,22)(H2,19,21,23)/t12-,13+,15+/m0/s1 |
| InChIKey | PIQPLEMKIUPDRB-GZBFAFLISA-N |
| XLogP | 3.16 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|