C23H29N3O3S — CID 8660288
N-[2,5-dimethoxy-4-[[(1S,2R)-2-methylcyclohexyl]carbamothioylamino]phenyl]benzamide (PubChem CID 8660288) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is N-[2,5-dimethoxy-4-[[(1S,2R)-2-methylcyclohexyl]carbamothioylamino]phenyl]benzamide.
| Compound Name | N-[2,5-dimethoxy-4-[[(1S,2R)-2-methylcyclohexyl]carbamothioylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 8660288 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | N-[2,5-dimethoxy-4-[[(1S,2R)-2-methylcyclohexyl]carbamothioylamino]phenyl]benzamide |
| SMILES | COc1cc(NC(=S)N[C@H]2CCCC[C@H]2C)c(OC)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H29N3O3S/c1-15-9-7-8-12-17(15)25-23(30)26-19-14-20(28-2)18(13-21(19)29-3)24-22(27)16-10-5-4-6-11-16/h4-6,10-11,13-15,17H,7-9,12H2,1-3H3,(H,24,27)(H2,25,26,30)/t15-,17+/m1/s1 |
| InChIKey | IZPLMZQIUTWKKP-WBVHZDCISA-N |
| XLogP | 4.82 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|