C15H22N2O2 — CID 40636375
1-(2-methoxyphenyl)-3-[(1R,2R)-2-methylcyclohexyl]urea (PubChem CID 40636375) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[(1R,2R)-2-methylcyclohexyl]urea.
| Compound Name | 1-(2-methoxyphenyl)-3-[(1R,2R)-2-methylcyclohexyl]urea |
|---|---|
| PubChem CID | 40636375 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[(1R,2R)-2-methylcyclohexyl]urea |
| SMILES | COc1ccccc1NC(=O)N[C@@H]1CCCC[C@H]1C |
| InChI | InChI=1S/C15H22N2O2/c1-11-7-3-4-8-12(11)16-15(18)17-13-9-5-6-10-14(13)19-2/h5-6,9-12H,3-4,7-8H2,1-2H3,(H2,16,17,18)/t11-,12-/m1/s1 |
| InChIKey | GUCYJTFAYNKTRQ-VXGBXAGGSA-N |
| XLogP | 3.40 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |