C16H24N2O2 — CID 94081568
1-[2-(methoxymethyl)phenyl]-3-[(1S,2R)-2-methylcyclohexyl]urea (PubChem CID 94081568) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-[2-(methoxymethyl)phenyl]-3-[(1S,2R)-2-methylcyclohexyl]urea.
| Compound Name | 1-[2-(methoxymethyl)phenyl]-3-[(1S,2R)-2-methylcyclohexyl]urea |
|---|---|
| PubChem CID | 94081568 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-[2-(methoxymethyl)phenyl]-3-[(1S,2R)-2-methylcyclohexyl]urea |
| SMILES | COCc1ccccc1NC(=O)N[C@H]1CCCC[C@H]1C |
| InChI | InChI=1S/C16H24N2O2/c1-12-7-3-5-9-14(12)17-16(19)18-15-10-6-4-8-13(15)11-20-2/h4,6,8,10,12,14H,3,5,7,9,11H2,1-2H3,(H2,17,18,19)/t12-,14+/m1/s1 |
| InChIKey | YKSGVQNFCPBWIP-OCCSQVGLSA-N |
| XLogP | 3.53 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |