C17H23N3O — CID 40519549
1-[(1R,2R)-2-methylcyclohexyl]-3-(1-methylindol-3-yl)urea (PubChem CID 40519549) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-[(1R,2R)-2-methylcyclohexyl]-3-(1-methylindol-3-yl)urea.
| Compound Name | 1-[(1R,2R)-2-methylcyclohexyl]-3-(1-methylindol-3-yl)urea |
|---|---|
| PubChem CID | 40519549 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 1-[(1R,2R)-2-methylcyclohexyl]-3-(1-methylindol-3-yl)urea |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)Nc1cn(C)c2ccccc12 |
| InChI | InChI=1S/C17H23N3O/c1-12-7-3-5-9-14(12)18-17(21)19-15-11-20(2)16-10-6-4-8-13(15)16/h4,6,8,10-12,14H,3,5,7,9H2,1-2H3,(H2,18,19,21)/t12-,14-/m1/s1 |
| InChIKey | JLIYNKZKLNKSSI-TZMCWYRMSA-N |
| XLogP | 3.88 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |