C17H23N3O — CID 42551679
(3R,5S)-3,5-dimethyl-N-(1-methylindol-3-yl)piperidine-1-carboxamide (PubChem CID 42551679) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is (3R,5S)-3,5-dimethyl-N-(1-methylindol-3-yl)piperidine-1-carboxamide.
| Compound Name | (3R,5S)-3,5-dimethyl-N-(1-methylindol-3-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 42551679 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | (3R,5S)-3,5-dimethyl-N-(1-methylindol-3-yl)piperidine-1-carboxamide |
| SMILES | C[C@@H]1C[C@H](C)CN(C(=O)Nc2cn(C)c3ccccc23)C1 |
| InChI | InChI=1S/C17H23N3O/c1-12-8-13(2)10-20(9-12)17(21)18-15-11-19(3)16-7-5-4-6-14(15)16/h4-7,11-13H,8-10H2,1-3H3,(H,18,21)/t12-,13+ |
| InChIKey | BSJVRBBCSGAOQB-BETUJISGSA-N |
| XLogP | 3.69 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |