C14H19ClN2O — CID 40638803
(3R,5R)-N-(2-chlorophenyl)-3,5-dimethylpiperidine-1-carboxamide (PubChem CID 40638803) has the molecular formula C14H19ClN2O and a molecular weight of 266.77 g/mol. Its IUPAC name is (3R,5R)-N-(2-chlorophenyl)-3,5-dimethylpiperidine-1-carboxamide.
| Compound Name | (3R,5R)-N-(2-chlorophenyl)-3,5-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 40638803 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (3R,5R)-N-(2-chlorophenyl)-3,5-dimethylpiperidine-1-carboxamide |
| SMILES | C[C@@H]1C[C@@H](C)CN(C(=O)Nc2ccccc2Cl)C1 |
| InChI | InChI=1S/C14H19ClN2O/c1-10-7-11(2)9-17(8-10)14(18)16-13-6-4-3-5-12(13)15/h3-6,10-11H,7-9H2,1-2H3,(H,16,18)/t10-,11-/m1/s1 |
| InChIKey | IXOXWGHFGXROPX-GHMZBOCLSA-N |
| XLogP | 3.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |