C15H21ClN4O — CID 23140017
N-(2-chlorophenyl)-3-(4-methylpiperazin-1-yl)azetidine-1-carboxamide (PubChem CID 23140017) has the molecular formula C15H21ClN4O and a molecular weight of 308.81 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3-(4-methylpiperazin-1-yl)azetidine-1-carboxamide.
| Compound Name | N-(2-chlorophenyl)-3-(4-methylpiperazin-1-yl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 23140017 |
| Molecular Formula | C15H21ClN4O |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | N-(2-chlorophenyl)-3-(4-methylpiperazin-1-yl)azetidine-1-carboxamide |
| SMILES | CN1CCN(C2CN(C(=O)Nc3ccccc3Cl)C2)CC1 |
| InChI | InChI=1S/C15H21ClN4O/c1-18-6-8-19(9-7-18)12-10-20(11-12)15(21)17-14-5-3-2-4-13(14)16/h2-5,12H,6-11H2,1H3,(H,17,21) |
| InChIKey | ZNSCIZZSJOENMZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |