C19H29ClN4O — CID 97253562
(3R)-N-(2-chloro-4-methylphenyl)-3-(4-methylpiperazin-1-yl)azepane-1-carboxamide (PubChem CID 97253562) has the molecular formula C19H29ClN4O and a molecular weight of 364.92 g/mol. Its IUPAC name is (3R)-N-(2-chloro-4-methylphenyl)-3-(4-methylpiperazin-1-yl)azepane-1-carboxamide.
| Compound Name | (3R)-N-(2-chloro-4-methylphenyl)-3-(4-methylpiperazin-1-yl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 97253562 |
| Molecular Formula | C19H29ClN4O |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (3R)-N-(2-chloro-4-methylphenyl)-3-(4-methylpiperazin-1-yl)azepane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCCC[C@@H](N3CCN(C)CC3)C2)c(Cl)c1 |
| InChI | InChI=1S/C19H29ClN4O/c1-15-6-7-18(17(20)13-15)21-19(25)24-8-4-3-5-16(14-24)23-11-9-22(2)10-12-23/h6-7,13,16H,3-5,8-12,14H2,1-2H3,(H,21,25)/t16-/m1/s1 |
| InChIKey | BSMMRWBEPNNIPK-MRXNPFEDSA-N |
| XLogP | 3.28 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |