C16H22ClN3O — CID 20920182
N-(5-chloro-2-methylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxamide (PubChem CID 20920182) has the molecular formula C16H22ClN3O and a molecular weight of 307.82 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 20920182 |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C16H22ClN3O/c1-12-5-6-13(17)10-15(12)18-16(21)20-9-8-19-7-3-2-4-14(19)11-20/h5-6,10,14H,2-4,7-9,11H2,1H3,(H,18,21) |
| InChIKey | RAAGTZUWXSWKDX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |