C24H36N4O2 — CID 56796327
N-[4-(cyclohexylcarbamoyl)-2-methylphenyl]-3-pyrrolidin-1-ylpiperidine-1-carboxamide (PubChem CID 56796327) has the molecular formula C24H36N4O2 and a molecular weight of 412.58 g/mol. Its IUPAC name is N-[4-(cyclohexylcarbamoyl)-2-methylphenyl]-3-pyrrolidin-1-ylpiperidine-1-carboxamide.
| Compound Name | N-[4-(cyclohexylcarbamoyl)-2-methylphenyl]-3-pyrrolidin-1-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 56796327 |
| Molecular Formula | C24H36N4O2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | N-[4-(cyclohexylcarbamoyl)-2-methylphenyl]-3-pyrrolidin-1-ylpiperidine-1-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCCCC2)ccc1NC(=O)N1CCCC(N2CCCC2)C1 |
| InChI | InChI=1S/C24H36N4O2/c1-18-16-19(23(29)25-20-8-3-2-4-9-20)11-12-22(18)26-24(30)28-15-7-10-21(17-28)27-13-5-6-14-27/h11-12,16,20-21H,2-10,13-15,17H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | ZHAYCRKRMZTAII-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |