C29H31N3O3 — CID 55878666
3-benzamido-N-[4-(cyclohexylcarbamoyl)-2-methylphenyl]-4-methylbenzamide (PubChem CID 55878666) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is 3-benzamido-N-[4-(cyclohexylcarbamoyl)-2-methylphenyl]-4-methylbenzamide.
| Compound Name | 3-benzamido-N-[4-(cyclohexylcarbamoyl)-2-methylphenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 55878666 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 3-benzamido-N-[4-(cyclohexylcarbamoyl)-2-methylphenyl]-4-methylbenzamide |
| SMILES | Cc1cc(C(=O)NC2CCCCC2)ccc1NC(=O)c1ccc(C)c(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C29H31N3O3/c1-19-13-14-23(18-26(19)32-27(33)21-9-5-3-6-10-21)29(35)31-25-16-15-22(17-20(25)2)28(34)30-24-11-7-4-8-12-24/h3,5-6,9-10,13-18,24H,4,7-8,11-12H2,1-2H3,(H,30,34)(H,31,35)(H,32,33) |
| InChIKey | OOWZONMNVBQOSC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |